C17H24N4O2 — CID 91105288
5-(5-aminooctyl)-3-pyridin-3-yl-1,2-oxazole-4-carboxamide (PubChem CID 91105288) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 5-(5-aminooctyl)-3-pyridin-3-yl-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(5-aminooctyl)-3-pyridin-3-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 91105288 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 5-(5-aminooctyl)-3-pyridin-3-yl-1,2-oxazole-4-carboxamide |
| SMILES | CCCC(N)CCCCc1onc(-c2cccnc2)c1C(N)=O |
| InChI | InChI=1S/C17H24N4O2/c1-2-6-13(18)8-3-4-9-14-15(17(19)22)16(21-23-14)12-7-5-10-20-11-12/h5,7,10-11,13H,2-4,6,8-9,18H2,1H3,(H2,19,22) |
| InChIKey | LBWPUFYXMOZHIG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|