C10H10N2O3S2 — CID 9111101
(4-formyl-2-nitrophenyl) N,N-dimethylcarbamodithioate (PubChem CID 9111101) has the molecular formula C10H10N2O3S2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (4-formyl-2-nitrophenyl) N,N-dimethylcarbamodithioate.
| Compound Name | (4-formyl-2-nitrophenyl) N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 9111101 |
| Molecular Formula | C10H10N2O3S2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | (4-formyl-2-nitrophenyl) N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)Sc1ccc(C=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O3S2/c1-11(2)10(16)17-9-4-3-7(6-13)5-8(9)12(14)15/h3-6H,1-2H3 |
| InChIKey | PCPSQVYAZUGCES-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|