C12H17N3O4S3 — CID 9111158
[2-nitro-4-(propan-2-ylsulfamoyl)phenyl] N,N-dimethylcarbamodithioate (PubChem CID 9111158) has the molecular formula C12H17N3O4S3 and a molecular weight of 363.49 g/mol. Its IUPAC name is [2-nitro-4-(propan-2-ylsulfamoyl)phenyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-nitro-4-(propan-2-ylsulfamoyl)phenyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 9111158 |
| Molecular Formula | C12H17N3O4S3 |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | [2-nitro-4-(propan-2-ylsulfamoyl)phenyl] N,N-dimethylcarbamodithioate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(SC(=S)N(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H17N3O4S3/c1-8(2)13-22(18,19)9-5-6-11(10(7-9)15(16)17)21-12(20)14(3)4/h5-8,13H,1-4H3 |
| InChIKey | XSYXHYFJTDZNIN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|