C24H28N6OS — CID 91111192
2-ethyl-7-[3-[(4-methyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-6,7,8,9-tetrahydro-5H-[1,3]oxazolo[4,5-h][1]benzazepine (PubChem CID 91111192) has the molecular formula C24H28N6OS and a molecular weight of 448.60 g/mol. Its IUPAC name is 2-ethyl-7-[3-[(4-methyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-6,7,8,9-tetrahydro-5H-[1,3]oxazolo[4,5-h][1]benzazepine.
| Compound Name | 2-ethyl-7-[3-[(4-methyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-6,7,8,9-tetrahydro-5H-[1,3]oxazolo[4,5-h][1]benzazepine |
|---|---|
| PubChem CID | 91111192 |
| Molecular Formula | C24H28N6OS |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-ethyl-7-[3-[(4-methyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-6,7,8,9-tetrahydro-5H-[1,3]oxazolo[4,5-h][1]benzazepine |
| SMILES | CCc1nc2cc3c(cc2o1)NCC(CCCSc1nnc(-c2cccnc2)n1C)CC3 |
| InChI | InChI=1S/C24H28N6OS/c1-3-22-27-20-12-17-9-8-16(14-26-19(17)13-21(20)31-22)6-5-11-32-24-29-28-23(30(24)2)18-7-4-10-25-15-18/h4,7,10,12-13,15-16,26H,3,5-6,8-9,11,14H2,1-2H3 |
| InChIKey | FEKJGICOMDXFBZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|