C27H35N3 — CID 91111848
2,3,4-tritert-butyl-5,6-dipyridin-2-ylpyridine (PubChem CID 91111848) has the molecular formula C27H35N3 and a molecular weight of 401.60 g/mol. Its IUPAC name is 2,3,4-tritert-butyl-5,6-dipyridin-2-ylpyridine.
| Compound Name | 2,3,4-tritert-butyl-5,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 91111848 |
| Molecular Formula | C27H35N3 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 2,3,4-tritert-butyl-5,6-dipyridin-2-ylpyridine |
| SMILES | CC(C)(C)c1nc(-c2ccccn2)c(-c2ccccn2)c(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C27H35N3/c1-25(2,3)21-20(18-14-10-12-16-28-18)23(19-15-11-13-17-29-19)30-24(27(7,8)9)22(21)26(4,5)6/h10-17H,1-9H3 |
| InChIKey | BUIDHXMBIFCJEZ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |