C25H24N3O2+ — CID 91112398
1-[7-(1-methylpyrrolidin-1-ium-1-carbonyl)-2-phenyl-5H-pyrido[3,2-b]indol-4-yl]ethanone (PubChem CID 91112398) has the molecular formula C25H24N3O2+ and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-[7-(1-methylpyrrolidin-1-ium-1-carbonyl)-2-phenyl-5H-pyrido[3,2-b]indol-4-yl]ethanone.
| Compound Name | 1-[7-(1-methylpyrrolidin-1-ium-1-carbonyl)-2-phenyl-5H-pyrido[3,2-b]indol-4-yl]ethanone |
|---|---|
| PubChem CID | 91112398 |
| Molecular Formula | C25H24N3O2+ |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-[7-(1-methylpyrrolidin-1-ium-1-carbonyl)-2-phenyl-5H-pyrido[3,2-b]indol-4-yl]ethanone |
| SMILES | CC(=O)c1cc(-c2ccccc2)nc2c1[nH]c1cc(C(=O)[N+]3(C)CCCC3)ccc12 |
| InChI | InChI=1S/C25H23N3O2/c1-16(29)20-15-21(17-8-4-3-5-9-17)26-23-19-11-10-18(14-22(19)27-24(20)23)25(30)28(2)12-6-7-13-28/h3-5,8-11,14-15H,6-7,12-13H2,1-2H3/p+1 |
| InChIKey | WJBJIHSHWICKMI-UHFFFAOYSA-O |
| XLogP | 4.97 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|