C54H98N4O12 — CID 91112638
6-(2-acetamido-4-methylpentanoyl)oxyhexyl 4-methyl-2-(methylamino)pentanoate;6-[2-[[(E)-but-2-enoyl]amino]-4-methylpentanoyl]oxyhexyl 4-methyl-2-(10-oxoundecanoylamino)pentanoate (PubChem CID 91112638) has the molecular formula C54H98N4O12 and a molecular weight of 995.39 g/mol. Its IUPAC name is 6-(2-acetamido-4-methylpentanoyl)oxyhexyl 4-methyl-2-(methylamino)pentanoate;6-[2-[[(E)-but-2-enoyl]amino]-4-methylpentanoyl]oxyhexyl 4-methyl-2-(10-oxoundecanoylamino)pentanoate.
| Compound Name | 6-(2-acetamido-4-methylpentanoyl)oxyhexyl 4-methyl-2-(methylamino)pentanoate;6-[2-[[(E)-but-2-enoyl]amino]-4-methylpentanoyl]oxyhexyl 4-methyl-2-(10-oxoundecanoylamino)pentanoate |
|---|---|
| PubChem CID | 91112638 |
| Molecular Formula | C54H98N4O12 |
| Molecular Weight | 995.39 g/mol |
| Exact Mass | 994.72 |
| IUPAC Name | 6-(2-acetamido-4-methylpentanoyl)oxyhexyl 4-methyl-2-(methylamino)pentanoate;6-[2-[[(E)-but-2-enoyl]amino]-4-methylpentanoyl]oxyhexyl 4-methyl-2-(10-oxoundecanoylamino)pentanoate |
| SMILES | C/C=C/C(=O)NC(CC(C)C)C(=O)OCCCCCCOC(=O)C(CC(C)C)NC(=O)CCCCCCCCC(C)=O.CNC(CC(C)C)C(=O)OCCCCCCOC(=O)C(CC(C)C)NC(C)=O |
| InChI | InChI=1S/C33H58N2O7.C21H40N2O5/c1-7-18-30(37)34-28(23-25(2)3)32(39)41-21-16-12-13-17-22-42-33(40)29(24-26(4)5)35-31(38)20-15-11-9-8-10-14-19-27(6)36;1-15(2)13-18(22-6)20(25)27-11-9-7-8-10-12-28-21(26)19(14-16(3)4)23-17(5)24/h7,18,25-26,28-29H,8-17,19-24H2,1-6H3,(H,34,37)(H,35,38);15-16,18-19,22H,7-14H2,1-6H3,(H,23,24)/b18-7+; |
| InChIKey | YMRHDLLYIYNCBF-CWSPIBBISA-N |
| XLogP | 8.80 |
| TPSA | 221.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.39 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|