C48H82N4O10 — CID 90932474
benzyl 2-(methylamino)-6-(6-oxohexanoylamino)hexanoate;6-[4-methyl-2-(8-oxononanoylamino)pentanoyl]oxyhexyl 4-methyl-2-(methylamino)pentanoate (PubChem CID 90932474) has the molecular formula C48H82N4O10 and a molecular weight of 875.20 g/mol. Its IUPAC name is benzyl 2-(methylamino)-6-(6-oxohexanoylamino)hexanoate;6-[4-methyl-2-(8-oxononanoylamino)pentanoyl]oxyhexyl 4-methyl-2-(methylamino)pentanoate.
| Compound Name | benzyl 2-(methylamino)-6-(6-oxohexanoylamino)hexanoate;6-[4-methyl-2-(8-oxononanoylamino)pentanoyl]oxyhexyl 4-methyl-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 90932474 |
| Molecular Formula | C48H82N4O10 |
| Molecular Weight | 875.20 g/mol |
| Exact Mass | 874.60 |
| IUPAC Name | benzyl 2-(methylamino)-6-(6-oxohexanoylamino)hexanoate;6-[4-methyl-2-(8-oxononanoylamino)pentanoyl]oxyhexyl 4-methyl-2-(methylamino)pentanoate |
| SMILES | CNC(CC(C)C)C(=O)OCCCCCCOC(=O)C(CC(C)C)NC(=O)CCCCCCC(C)=O.CNC(CCCCNC(=O)CCCCC=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H52N2O6.C20H30N2O4/c1-21(2)19-24(29-6)27(33)35-17-13-9-10-14-18-36-28(34)25(20-22(3)4)30-26(32)16-12-8-7-11-15-23(5)31;1-21-18(20(25)26-16-17-10-4-2-5-11-17)12-7-8-14-22-19(24)13-6-3-9-15-23/h21-22,24-25,29H,7-20H2,1-6H3,(H,30,32);2,4-5,10-11,15,18,21H,3,6-9,12-14,16H2,1H3,(H,22,24) |
| InChIKey | BDVBJESMWRJZOV-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 195.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.20 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|