C28H34BrFN2O2Si — CID 91112726
4-(bromomethyl)-7-[(4-fluorophenyl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol (PubChem CID 91112726) has the molecular formula C28H34BrFN2O2Si and a molecular weight of 557.58 g/mol. Its IUPAC name is 4-(bromomethyl)-7-[(4-fluorophenyl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol.
| Compound Name | 4-(bromomethyl)-7-[(4-fluorophenyl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol |
|---|---|
| PubChem CID | 91112726 |
| Molecular Formula | C28H34BrFN2O2Si |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 4-(bromomethyl)-7-[(4-fluorophenyl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol |
| SMILES | CC(C)[Si](Oc1c2nccc(CBr)c2cc2cn(Cc3ccc(F)cc3)c(O)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H34BrFN2O2Si/c1-17(2)35(18(3)4,19(5)6)34-27-25-22(13-24-21(14-29)11-12-31-26(24)27)16-32(28(25)33)15-20-7-9-23(30)10-8-20/h7-13,16-19,33H,14-15H2,1-6H3 |
| InChIKey | KVHVTEFZVNASBV-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|