C42H35N3O3 — CID 91113716
4-anilino-6,7-bis[4-(dimethylamino)phenyl]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 91113716) has the molecular formula C42H35N3O3 and a molecular weight of 629.76 g/mol. Its IUPAC name is 4-anilino-6,7-bis[4-(dimethylamino)phenyl]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 4-anilino-6,7-bis[4-(dimethylamino)phenyl]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 91113716 |
| Molecular Formula | C42H35N3O3 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.27 |
| IUPAC Name | 4-anilino-6,7-bis[4-(dimethylamino)phenyl]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CN(C)c1ccc(-c2cc(Nc3ccccc3)c3c(c2-c2ccc(N(C)C)cc2)C(=O)OC32c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C42H35N3O3/c1-44(2)30-22-18-27(19-23-30)32-26-35(43-29-12-6-5-7-13-29)40-39(38(32)28-20-24-31(25-21-28)45(3)4)41(46)48-42(40)33-14-8-10-16-36(33)47-37-17-11-9-15-34(37)42/h5-26,43H,1-4H3 |
| InChIKey | CJQSEBXHZUZZAO-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |