C19H30F3NO — CID 91115479
2-ethenyl-6,6,6-trifluoro-5-methyl-N-(4-propylheptan-3-yl)hexa-2,4-dienamide (PubChem CID 91115479) has the molecular formula C19H30F3NO and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-ethenyl-6,6,6-trifluoro-5-methyl-N-(4-propylheptan-3-yl)hexa-2,4-dienamide.
| Compound Name | 2-ethenyl-6,6,6-trifluoro-5-methyl-N-(4-propylheptan-3-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 91115479 |
| Molecular Formula | C19H30F3NO |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 2-ethenyl-6,6,6-trifluoro-5-methyl-N-(4-propylheptan-3-yl)hexa-2,4-dienamide |
| SMILES | C=CC(=CC=C(C)C(F)(F)F)C(=O)NC(CC)C(CCC)CCC |
| InChI | InChI=1S/C19H30F3NO/c1-6-10-16(11-7-2)17(9-4)23-18(24)15(8-3)13-12-14(5)19(20,21)22/h8,12-13,16-17H,3,6-7,9-11H2,1-2,4-5H3,(H,23,24) |
| InChIKey | MLLLJHKRGQOPEH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|