C33H40Cl2N6O5S — CID 91117912
2-[[2-[(2,4-dichloro-3-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetyl]amino]-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-N-(2-pyrrolidin-1-ylethyl)acetamide (PubChem CID 91117912) has the molecular formula C33H40Cl2N6O5S and a molecular weight of 703.69 g/mol. Its IUPAC name is 2-[[2-[(2,4-dichloro-3-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetyl]amino]-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-N-(2-pyrrolidin-1-ylethyl)acetamide.
| Compound Name | 2-[[2-[(2,4-dichloro-3-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetyl]amino]-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-N-(2-pyrrolidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 91117912 |
| Molecular Formula | C33H40Cl2N6O5S |
| Molecular Weight | 703.69 g/mol |
| Exact Mass | 702.22 |
| IUPAC Name | 2-[[2-[(2,4-dichloro-3-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetyl]amino]-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-N-(2-pyrrolidin-1-ylethyl)acetamide |
| SMILES | Cc1c(Cl)ccc(S(=O)(=O)N(CCc2ccccc2)CC(=O)NCC(=O)N(CCN2CCCC2)Cc2ccc(C(N)=NO)cc2)c1Cl |
| InChI | InChI=1S/C33H40Cl2N6O5S/c1-24-28(34)13-14-29(32(24)35)47(45,46)41(18-15-25-7-3-2-4-8-25)23-30(42)37-21-31(43)40(20-19-39-16-5-6-17-39)22-26-9-11-27(12-10-26)33(36)38-44/h2-4,7-14,44H,5-6,15-23H2,1H3,(H2,36,38)(H,37,42) |
| InChIKey | KDMPNOWQQAJBKX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|