C35H42Cl2N6O6S — CID 91509961
[[amino-[4-[[[2-[[2-[(2,4-dichloro-3-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetyl]amino]acetyl]-(2-pyrrolidin-1-ylethyl)amino]methyl]phenyl]methylidene]amino] acetate (PubChem CID 91509961) has the molecular formula C35H42Cl2N6O6S and a molecular weight of 745.73 g/mol. Its IUPAC name is [[amino-[4-[[[2-[[2-[(2,4-dichloro-3-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetyl]amino]acetyl]-(2-pyrrolidin-1-ylethyl)amino]methyl]phenyl]methylidene]amino] acetate.
| Compound Name | [[amino-[4-[[[2-[[2-[(2,4-dichloro-3-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetyl]amino]acetyl]-(2-pyrrolidin-1-ylethyl)amino]methyl]phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 91509961 |
| Molecular Formula | C35H42Cl2N6O6S |
| Molecular Weight | 745.73 g/mol |
| Exact Mass | 744.23 |
| IUPAC Name | [[amino-[4-[[[2-[[2-[(2,4-dichloro-3-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetyl]amino]acetyl]-(2-pyrrolidin-1-ylethyl)amino]methyl]phenyl]methylidene]amino] acetate |
| SMILES | CC(=O)ON=C(N)c1ccc(CN(CCN2CCCC2)C(=O)CNC(=O)CN(CCc2ccccc2)S(=O)(=O)c2ccc(Cl)c(C)c2Cl)cc1 |
| InChI | InChI=1S/C35H42Cl2N6O6S/c1-25-30(36)14-15-31(34(25)37)50(47,48)43(19-16-27-8-4-3-5-9-27)24-32(45)39-22-33(46)42(21-20-41-17-6-7-18-41)23-28-10-12-29(13-11-28)35(38)40-49-26(2)44/h3-5,8-15H,6-7,16-24H2,1-2H3,(H2,38,40)(H,39,45) |
| InChIKey | JUWMTEPOXMCZDI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 154.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|