C21H37N7O3 — CID 91126486
N-(4-cyano-1-methylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide (PubChem CID 91126486) has the molecular formula C21H37N7O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-(4-cyano-1-methylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide.
| Compound Name | N-(4-cyano-1-methylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 91126486 |
| Molecular Formula | C21H37N7O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | N-(4-cyano-1-methylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide |
| SMILES | CCNC(=O)N/C(=N\C(CC(C)C)C(=O)NC1(C#N)CCN(C)CC1)N1CCOCC1 |
| InChI | InChI=1S/C21H37N7O3/c1-5-23-20(30)25-19(28-10-12-31-13-11-28)24-17(14-16(2)3)18(29)26-21(15-22)6-8-27(4)9-7-21/h16-17H,5-14H2,1-4H3,(H,26,29)(H2,23,24,25,30) |
| InChIKey | ALNNBCPXSPOBHZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|