C31H38N2O7 — CID 91126964
(2R,4R,4aR,5aR,11aS,12aR)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-(2-pyridin-2-ylethyl)-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 91126964) has the molecular formula C31H38N2O7 and a molecular weight of 550.65 g/mol. Its IUPAC name is (2R,4R,4aR,5aR,11aS,12aR)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-(2-pyridin-2-ylethyl)-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (2R,4R,4aR,5aR,11aS,12aR)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-(2-pyridin-2-ylethyl)-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91126964 |
| Molecular Formula | C31H38N2O7 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | (2R,4R,4aR,5aR,11aS,12aR)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-(2-pyridin-2-ylethyl)-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(C)[C@H]1C(O)[C@@H](C(N)=O)C(=O)[C@]2(O)C(O)[C@H]3C(=O)c4c(O)ccc(CCc5ccccn5)c4C[C@]3(C)C[C@]12C |
| InChI | InChI=1S/C31H38N2O7/c1-15(2)22-25(36)21(28(32)39)26(37)31(40)27(38)23-24(35)20-18(13-29(23,3)14-30(22,31)4)16(9-11-19(20)34)8-10-17-7-5-6-12-33-17/h5-7,9,11-12,15,21-23,25,27,34,36,38,40H,8,10,13-14H2,1-4H3,(H2,32,39)/t21-,22+,23-,25?,27?,29-,30-,31+/m1/s1 |
| InChIKey | OFWPJKCSDGWOPR-XQVBKKDHSA-N |
| XLogP | 1.75 |
| TPSA | 171.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|