C12H18N2O4 — CID 91127286
(2,5-dihydroxypyrrol-1-yl) N-cycloheptylcarbamate (PubChem CID 91127286) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) N-cycloheptylcarbamate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) N-cycloheptylcarbamate |
|---|---|
| PubChem CID | 91127286 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) N-cycloheptylcarbamate |
| SMILES | O=C(NC1CCCCCC1)On1c(O)ccc1O |
| InChI | InChI=1S/C12H18N2O4/c15-10-7-8-11(16)14(10)18-12(17)13-9-5-3-1-2-4-6-9/h7-9,15-16H,1-6H2,(H,13,17) |
| InChIKey | BGMYOQBCNHBDJS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |