C14H22O — CID 91128535
2-methylidene-1,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydrobenzo[c]chromene (PubChem CID 91128535) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-methylidene-1,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydrobenzo[c]chromene.
| Compound Name | 2-methylidene-1,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 91128535 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2-methylidene-1,3,4,4a,6,6a,7,8,9,10,10a,10b-dodecahydrobenzo[c]chromene |
| SMILES | C=C1CCC2OCC3CCCCC3C2C1 |
| InChI | InChI=1S/C14H22O/c1-10-6-7-14-13(8-10)12-5-3-2-4-11(12)9-15-14/h11-14H,1-9H2 |
| InChIKey | WGDQBTUBOJKLSE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|