C34H48O8 — CID 91129463
[(3S,5S)-6-(hydroxymethyl)-2-(8-methoxyoct-4-enoxy)-4,5-bis(phenylmethoxy)oxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 91129463) has the molecular formula C34H48O8 and a molecular weight of 584.75 g/mol. Its IUPAC name is [(3S,5S)-6-(hydroxymethyl)-2-(8-methoxyoct-4-enoxy)-4,5-bis(phenylmethoxy)oxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,5S)-6-(hydroxymethyl)-2-(8-methoxyoct-4-enoxy)-4,5-bis(phenylmethoxy)oxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 91129463 |
| Molecular Formula | C34H48O8 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | [(3S,5S)-6-(hydroxymethyl)-2-(8-methoxyoct-4-enoxy)-4,5-bis(phenylmethoxy)oxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | COCCCC=CCCCOC1OC(CO)[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C34H48O8/c1-34(2,3)33(36)42-31-30(40-25-27-19-13-10-14-20-27)29(39-24-26-17-11-9-12-18-26)28(23-35)41-32(31)38-22-16-8-6-5-7-15-21-37-4/h5-6,9-14,17-20,28-32,35H,7-8,15-16,21-25H2,1-4H3/t28?,29-,30?,31-,32?/m0/s1 |
| InChIKey | GUUFCBQYWPSAKT-XXIFUGLNSA-N |
| XLogP | 5.61 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|