C14H24O2 — CID 91129502
4-(2,5-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-1,3-dioxane (PubChem CID 91129502) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 4-(2,5-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-1,3-dioxane.
| Compound Name | 4-(2,5-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 91129502 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 4-(2,5-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-1,3-dioxane |
| SMILES | CC1C=CC(C)C(C2OC(C)OCC2C)C1 |
| InChI | InChI=1S/C14H24O2/c1-9-5-6-10(2)13(7-9)14-11(3)8-15-12(4)16-14/h5-6,9-14H,7-8H2,1-4H3 |
| InChIKey | XKQKHODGZRYFSD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|