C11H18 — CID 162412469
(1S,2R,3aR,4S,6aR)-1,2,4-trimethyl-1,2,3,3a,4,6a-hexahydropentalene (PubChem CID 162412469) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (1S,2R,3aR,4S,6aR)-1,2,4-trimethyl-1,2,3,3a,4,6a-hexahydropentalene.
| Compound Name | (1S,2R,3aR,4S,6aR)-1,2,4-trimethyl-1,2,3,3a,4,6a-hexahydropentalene |
|---|---|
| PubChem CID | 162412469 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (1S,2R,3aR,4S,6aR)-1,2,4-trimethyl-1,2,3,3a,4,6a-hexahydropentalene |
| SMILES | C[C@@H]1[C@H]2C=C[C@H](C)[C@H]2C[C@H]1C |
| InChI | InChI=1S/C11H18/c1-7-4-5-10-9(3)8(2)6-11(7)10/h4-5,7-11H,6H2,1-3H3/t7-,8+,9-,10+,11+/m0/s1 |
| InChIKey | CDMRUKHECHXCMT-OGBGREFGSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|