C11H16 — CID 163443583
(1R)-5-methyltricyclo[5.3.0.02,6]dec-3-ene (PubChem CID 163443583) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (1R)-5-methyltricyclo[5.3.0.02,6]dec-3-ene.
| Compound Name | (1R)-5-methyltricyclo[5.3.0.02,6]dec-3-ene |
|---|---|
| PubChem CID | 163443583 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (1R)-5-methyltricyclo[5.3.0.02,6]dec-3-ene |
| SMILES | CC1C=CC2C1C1CCC[C@@H]21 |
| InChI | InChI=1S/C11H16/c1-7-5-6-10-8-3-2-4-9(8)11(7)10/h5-11H,2-4H2,1H3/t7?,8-,9?,10?,11?/m1/s1 |
| InChIKey | BAPRAIHDVNCPRS-IYBWKAHUSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|