C16H20F12O — CID 91130093
1,1,1,2,2,3,3,4,4,5,5,6-dodecafluoro-6-prop-2-enoxytridecane (PubChem CID 91130093) has the molecular formula C16H20F12O and a molecular weight of 456.31 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluoro-6-prop-2-enoxytridecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluoro-6-prop-2-enoxytridecane |
|---|---|
| PubChem CID | 91130093 |
| Molecular Formula | C16H20F12O |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluoro-6-prop-2-enoxytridecane |
| SMILES | C=CCOC(F)(CCCCCCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H20F12O/c1-3-5-6-7-8-9-11(17,29-10-4-2)12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)28/h4H,2-3,5-10H2,1H3 |
| InChIKey | DOTMSNXLABHMOJ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|