C9H12S — CID 91132125
5,6,7,8-tetrahydro-2H-thiochromene (PubChem CID 91132125) has the molecular formula C9H12S and a molecular weight of 152.26 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-2H-thiochromene.
| Compound Name | 5,6,7,8-tetrahydro-2H-thiochromene |
|---|---|
| PubChem CID | 91132125 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 5,6,7,8-tetrahydro-2H-thiochromene |
| SMILES | C1=CC2=C(CCCC2)SC1 |
| InChI | InChI=1S/C9H12S/c1-2-6-9-8(4-1)5-3-7-10-9/h3,5H,1-2,4,6-7H2 |
| InChIKey | ZQHPEOBGKBGIJK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |