C28H22N4O9S — CID 91134400
(4aS,5aR,12aS)-10,12a-dihydroxy-7-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91134400) has the molecular formula C28H22N4O9S and a molecular weight of 590.57 g/mol. Its IUPAC name is (4aS,5aR,12aS)-10,12a-dihydroxy-7-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-10,12a-dihydroxy-7-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91134400 |
| Molecular Formula | C28H22N4O9S |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | (4aS,5aR,12aS)-10,12a-dihydroxy-7-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4c(Nc5nc(-c6cccc([N+](=O)[O-])c6)cs5)ccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C28H22N4O9S/c29-26(38)22-19(34)9-13-6-12-8-15-16(30-27-31-17(10-42-27)11-2-1-3-14(7-11)32(40)41)4-5-18(33)21(15)23(35)20(12)24(36)28(13,39)25(22)37/h1-5,7,10,12-13,20,22,33,39H,6,8-9H2,(H2,29,38)(H,30,31)/t12-,13+,20?,22?,28+/m1/s1 |
| InChIKey | USRFSASRQQBEDH-PCQBGVIKSA-N |
| XLogP | 2.10 |
| TPSA | 219.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|