C27H18F6N2O9 — CID 90750322
(4aS,5aR,12aS)-10,12a-dihydroxy-7-(3-nitrophenyl)-1,3,11,12-tetraoxo-N,9-bis(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90750322) has the molecular formula C27H18F6N2O9 and a molecular weight of 628.43 g/mol. Its IUPAC name is (4aS,5aR,12aS)-10,12a-dihydroxy-7-(3-nitrophenyl)-1,3,11,12-tetraoxo-N,9-bis(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-10,12a-dihydroxy-7-(3-nitrophenyl)-1,3,11,12-tetraoxo-N,9-bis(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90750322 |
| Molecular Formula | C27H18F6N2O9 |
| Molecular Weight | 628.43 g/mol |
| Exact Mass | 628.09 |
| IUPAC Name | (4aS,5aR,12aS)-10,12a-dihydroxy-7-(3-nitrophenyl)-1,3,11,12-tetraoxo-N,9-bis(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | O=C1C[C@@H]2C[C@@H]3Cc4c(-c5cccc([N+](=O)[O-])c5)cc(C(F)(F)F)c(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C1C(=O)NC(F)(F)F |
| InChI | InChI=1S/C27H18F6N2O9/c28-26(29,30)15-8-13(9-2-1-3-12(5-9)35(43)44)14-6-10-4-11-7-16(36)19(24(41)34-27(31,32)33)23(40)25(11,42)22(39)17(10)21(38)18(14)20(15)37/h1-3,5,8,10-11,17,19,37,42H,4,6-7H2,(H,34,41)/t10-,11+,17?,19?,25+/m1/s1 |
| InChIKey | HSISTQMBVJPCQM-GKTXMOKJSA-N |
| XLogP | 3.07 |
| TPSA | 180.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|