C26H21ClN4 — CID 91136284
4-(2-chlorophenyl)-5-isocyano-3-naphthalen-2-yl-6-propyl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine (PubChem CID 91136284) has the molecular formula C26H21ClN4 and a molecular weight of 424.94 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-isocyano-3-naphthalen-2-yl-6-propyl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 4-(2-chlorophenyl)-5-isocyano-3-naphthalen-2-yl-6-propyl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 91136284 |
| Molecular Formula | C26H21ClN4 |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 4-(2-chlorophenyl)-5-isocyano-3-naphthalen-2-yl-6-propyl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine |
| SMILES | [C-]#[N+]C1C(CCC)=Nc2n[nH]c(-c3ccc4ccccc4c3)c2C1c1ccccc1Cl |
| InChI | InChI=1S/C26H21ClN4/c1-3-8-21-25(28-2)22(19-11-6-7-12-20(19)27)23-24(30-31-26(23)29-21)18-14-13-16-9-4-5-10-17(16)15-18/h4-7,9-15,22,25H,3,8H2,1H3,(H,30,31) |
| InChIKey | SHTQOCWIMWBZFM-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|