C20H23ClN4O2 — CID 91071488
4-(2-chlorophenyl)-3-(2,2-dimethoxyethyl)-6-propyl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile (PubChem CID 91071488) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-3-(2,2-dimethoxyethyl)-6-propyl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
| Compound Name | 4-(2-chlorophenyl)-3-(2,2-dimethoxyethyl)-6-propyl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 91071488 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-(2-chlorophenyl)-3-(2,2-dimethoxyethyl)-6-propyl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
| SMILES | CCCC1=Nc2n[nH]c(CC(OC)OC)c2C(c2ccccc2Cl)C1C#N |
| InChI | InChI=1S/C20H23ClN4O2/c1-4-7-15-13(11-22)18(12-8-5-6-9-14(12)21)19-16(10-17(26-2)27-3)24-25-20(19)23-15/h5-6,8-9,13,17-18H,4,7,10H2,1-3H3,(H,24,25) |
| InChIKey | ILOHMUDZVSVSJW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|