About ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide
ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide (PubChem CID 91136473) has the molecular formula C15H23NO3
and a molecular weight of 265.35 g/mol. Its IUPAC name is ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide.
Molecular Properties
| Compound Name | ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide |
| PubChem CID | 91136473 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide |
| SMILES | CC.CC(=O)C(c1ccccc1)C(C)C(C)=[N+]([O-])O |
| InChI | InChI=1S/C13H17NO3.C2H6/c1-9(10(2)14(16)17)13(11(3)15)12-7-5-4-6-8-12;1-2/h4-9,13H,1-3H3,(H,16,17);1-2H3 |
| InChIKey | QKKJJLMSHDISBJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide?
The IUPAC name of ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide (CID 91136473) is ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide.
What is the SMILES notation for ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide?
The canonical SMILES for ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide is CC.CC(=O)C(c1ccccc1)C(C)C(C)=[N+]([O-])O.
What is the InChIKey of ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide?
The InChIKey is QKKJJLMSHDISBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3.C2H6/c1-9(10(2)14(16)17)13(11(3)15)12-7-5-4-6-8-12;1-2/h4-9,13H,1-3H3,(H,16,17);1-2H3.
What are the key properties of ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide?
ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide has a molecular weight of 265.35 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-hydroxy-3-methyl-5-oxo-4-phenylhexan-2-imine oxide is sourced from PubChem (CID 91136473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).