C22H32ClN5O4 — CID 91136765
N-[3-[butyl(propyl)amino]propyl]-5-chloro-2-[[2-(5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)acetyl]amino]benzamide (PubChem CID 91136765) has the molecular formula C22H32ClN5O4 and a molecular weight of 465.98 g/mol. Its IUPAC name is N-[3-[butyl(propyl)amino]propyl]-5-chloro-2-[[2-(5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)acetyl]amino]benzamide.
| Compound Name | N-[3-[butyl(propyl)amino]propyl]-5-chloro-2-[[2-(5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 91136765 |
| Molecular Formula | C22H32ClN5O4 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-[3-[butyl(propyl)amino]propyl]-5-chloro-2-[[2-(5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)acetyl]amino]benzamide |
| SMILES | CCCCN(CCC)CCCNC(=O)c1cc(Cl)ccc1NC(=O)Cc1[nH]c(=O)[nH]c1O |
| InChI | InChI=1S/C22H32ClN5O4/c1-3-5-11-28(10-4-2)12-6-9-24-20(30)16-13-15(23)7-8-17(16)25-19(29)14-18-21(31)27-22(32)26-18/h7-8,13,31H,3-6,9-12,14H2,1-2H3,(H,24,30)(H,25,29)(H2,26,27,32) |
| InChIKey | RGZDUBHDIAQTMQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 130.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|