C20H22BN4O5S — CID 91139021
CID 91139021 (PubChem CID 91139021) has the molecular formula C20H22BN4O5S and a molecular weight of 441.30 g/mol.
| Compound Name | CID 91139021 |
|---|---|
| PubChem CID | 91139021 |
| Molecular Formula | C20H22BN4O5S |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C(=O)NCC2CN(c3cc(C)c(N4C[B]NC4=O)c(CO)c3)C(=O)O2)s1 |
| InChI | InChI=1S/C20H22BN4O5S/c1-11-5-14(6-13(9-26)17(11)25-10-21-23-19(25)28)24-8-15(30-20(24)29)7-22-18(27)16-4-3-12(2)31-16/h3-6,15,26H,7-10H2,1-2H3,(H,22,27)(H,23,28) |
| InChIKey | HNRXXIISFUVRCL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|