C20H25FN4O2S — CID 91139201
1-[3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propoxy]phenyl]-1-sulfanylurea (PubChem CID 91139201) has the molecular formula C20H25FN4O2S and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-[3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propoxy]phenyl]-1-sulfanylurea.
| Compound Name | 1-[3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propoxy]phenyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 91139201 |
| Molecular Formula | C20H25FN4O2S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propoxy]phenyl]-1-sulfanylurea |
| SMILES | NC(=O)N(S)c1cccc(OCCCN2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C20H25FN4O2S/c21-18-7-1-2-8-19(18)24-12-10-23(11-13-24)9-4-14-27-17-6-3-5-16(15-17)25(28)20(22)26/h1-3,5-8,15,28H,4,9-14H2,(H2,22,26) |
| InChIKey | RILFBGZECKORCC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|