C21H25ClN4O2S2 — CID 87306524
1-[3-[5-[3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea (PubChem CID 87306524) has the molecular formula C21H25ClN4O2S2 and a molecular weight of 465.04 g/mol. Its IUPAC name is 1-[3-[5-[3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea.
| Compound Name | 1-[3-[5-[3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87306524 |
| Molecular Formula | C21H25ClN4O2S2 |
| Molecular Weight | 465.04 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 1-[3-[5-[3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea |
| SMILES | NC(=O)N(S)c1cccc(OCCCCCN2CCN(c3ccc(Cl)cc3)C2=S)c1 |
| InChI | InChI=1S/C21H25ClN4O2S2/c22-16-7-9-17(10-8-16)25-13-12-24(21(25)29)11-2-1-3-14-28-19-6-4-5-18(15-19)26(30)20(23)27/h4-10,15,30H,1-3,11-14H2,(H2,23,27) |
| InChIKey | HHMBOEZMVQYABN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.04 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|