C28H32N4O3S — CID 87306839
1-[3-[5-[3-(4-benzylphenyl)-2-oxoimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea (PubChem CID 87306839) has the molecular formula C28H32N4O3S and a molecular weight of 504.66 g/mol. Its IUPAC name is 1-[3-[5-[3-(4-benzylphenyl)-2-oxoimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea.
| Compound Name | 1-[3-[5-[3-(4-benzylphenyl)-2-oxoimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87306839 |
| Molecular Formula | C28H32N4O3S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 1-[3-[5-[3-(4-benzylphenyl)-2-oxoimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea |
| SMILES | NC(=O)N(S)c1cccc(OCCCCCN2CCN(c3ccc(Cc4ccccc4)cc3)C2=O)c1 |
| InChI | InChI=1S/C28H32N4O3S/c29-27(33)32(36)25-10-7-11-26(21-25)35-19-6-2-5-16-30-17-18-31(28(30)34)24-14-12-23(13-15-24)20-22-8-3-1-4-9-22/h1,3-4,7-15,21,36H,2,5-6,16-20H2,(H2,29,33) |
| InChIKey | OUBBQTISJIKFEY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|