C23H29ClN4O2S2 — CID 87307262
1-[3-[7-[3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-1-yl]heptoxy]phenyl]-1-sulfanylurea (PubChem CID 87307262) has the molecular formula C23H29ClN4O2S2 and a molecular weight of 493.10 g/mol. Its IUPAC name is 1-[3-[7-[3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-1-yl]heptoxy]phenyl]-1-sulfanylurea.
| Compound Name | 1-[3-[7-[3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-1-yl]heptoxy]phenyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87307262 |
| Molecular Formula | C23H29ClN4O2S2 |
| Molecular Weight | 493.10 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 1-[3-[7-[3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-1-yl]heptoxy]phenyl]-1-sulfanylurea |
| SMILES | NC(=O)N(S)c1cccc(OCCCCCCCN2CCN(c3ccc(Cl)cc3)C2=S)c1 |
| InChI | InChI=1S/C23H29ClN4O2S2/c24-18-9-11-19(12-10-18)27-15-14-26(23(27)31)13-4-2-1-3-5-16-30-21-8-6-7-20(17-21)28(32)22(25)29/h6-12,17,32H,1-5,13-16H2,(H2,25,29) |
| InChIKey | GMADFTZSYVSQLY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.10 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|