C27H36N4O2S2 — CID 91351140
1-[3-[1-[3-(4-cyclohexylphenyl)-2-sulfanylideneimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea (PubChem CID 91351140) has the molecular formula C27H36N4O2S2 and a molecular weight of 512.75 g/mol. Its IUPAC name is 1-[3-[1-[3-(4-cyclohexylphenyl)-2-sulfanylideneimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea.
| Compound Name | 1-[3-[1-[3-(4-cyclohexylphenyl)-2-sulfanylideneimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 91351140 |
| Molecular Formula | C27H36N4O2S2 |
| Molecular Weight | 512.75 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 1-[3-[1-[3-(4-cyclohexylphenyl)-2-sulfanylideneimidazolidin-1-yl]pentoxy]phenyl]-1-sulfanylurea |
| SMILES | CCCCC(Oc1cccc(N(S)C(N)=O)c1)N1CCN(c2ccc(C3CCCCC3)cc2)C1=S |
| InChI | InChI=1S/C27H36N4O2S2/c1-2-3-12-25(33-24-11-7-10-23(19-24)31(35)26(28)32)30-18-17-29(27(30)34)22-15-13-21(14-16-22)20-8-5-4-6-9-20/h7,10-11,13-16,19-20,25,35H,2-6,8-9,12,17-18H2,1H3,(H2,28,32) |
| InChIKey | ASFWYDKRTTZBJL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|