C22H23ClN2O3S — CID 90976725
1-[3-[1-(4-chloronaphthalen-1-yl)oxypentoxy]phenyl]-1-sulfanylurea (PubChem CID 90976725) has the molecular formula C22H23ClN2O3S and a molecular weight of 430.96 g/mol. Its IUPAC name is 1-[3-[1-(4-chloronaphthalen-1-yl)oxypentoxy]phenyl]-1-sulfanylurea.
| Compound Name | 1-[3-[1-(4-chloronaphthalen-1-yl)oxypentoxy]phenyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 90976725 |
| Molecular Formula | C22H23ClN2O3S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 1-[3-[1-(4-chloronaphthalen-1-yl)oxypentoxy]phenyl]-1-sulfanylurea |
| SMILES | CCCCC(Oc1cccc(N(S)C(N)=O)c1)Oc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C22H23ClN2O3S/c1-2-3-11-21(27-16-8-6-7-15(14-16)25(29)22(24)26)28-20-13-12-19(23)17-9-4-5-10-18(17)20/h4-10,12-14,21,29H,2-3,11H2,1H3,(H2,24,26) |
| InChIKey | UMMAICSLUCOJQT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|