C21H23N3O3S — CID 87604001
1-[3-(5-isoquinolin-5-yloxypentoxy)phenyl]-1-sulfanylurea (PubChem CID 87604001) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-[3-(5-isoquinolin-5-yloxypentoxy)phenyl]-1-sulfanylurea.
| Compound Name | 1-[3-(5-isoquinolin-5-yloxypentoxy)phenyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87604001 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 1-[3-(5-isoquinolin-5-yloxypentoxy)phenyl]-1-sulfanylurea |
| SMILES | NC(=O)N(S)c1cccc(OCCCCCOc2cccc3cnccc23)c1 |
| InChI | InChI=1S/C21H23N3O3S/c22-21(25)24(28)17-7-5-8-18(14-17)26-12-2-1-3-13-27-20-9-4-6-16-15-23-11-10-19(16)20/h4-11,14-15,28H,1-3,12-13H2,(H2,22,25) |
| InChIKey | NBYDQUGWVYMZRR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|