C23H29NO4 — CID 89266873
benzyl-[3-(9-oxononoxy)phenyl]carbamic acid (PubChem CID 89266873) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is benzyl-[3-(9-oxononoxy)phenyl]carbamic acid.
| Compound Name | benzyl-[3-(9-oxononoxy)phenyl]carbamic acid |
|---|---|
| PubChem CID | 89266873 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | benzyl-[3-(9-oxononoxy)phenyl]carbamic acid |
| SMILES | O=CCCCCCCCCOc1cccc(N(Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C23H29NO4/c25-16-9-4-2-1-3-5-10-17-28-22-15-11-14-21(18-22)24(23(26)27)19-20-12-7-6-8-13-20/h6-8,11-16,18H,1-5,9-10,17,19H2,(H,26,27) |
| InChIKey | MCOURYFUIWHOQB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|