C30H40N2O4 — CID 123904766
[3-(9-oxononoxy)phenyl] N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-N-benzylcarbamate (PubChem CID 123904766) has the molecular formula C30H40N2O4 and a molecular weight of 492.66 g/mol. Its IUPAC name is [3-(9-oxononoxy)phenyl] N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-N-benzylcarbamate.
| Compound Name | [3-(9-oxononoxy)phenyl] N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 123904766 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | [3-(9-oxononoxy)phenyl] N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-N-benzylcarbamate |
| SMILES | O=CCCCCCCCCOc1cccc(OC(=O)N(Cc2ccccc2)[C@H]2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C30H40N2O4/c33-20-9-4-2-1-3-5-10-21-35-27-14-11-15-28(22-27)36-30(34)32(23-25-12-7-6-8-13-25)29-24-31-18-16-26(29)17-19-31/h6-8,11-15,20,22,26,29H,1-5,9-10,16-19,21,23-24H2/t29-/m0/s1 |
| InChIKey | QBUFMTNOAVQMSU-LJAQVGFWSA-N |
| XLogP | 6.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|