C30H40N2O4 — CID 89406680
[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[3-(9-oxononoxy)phenyl]-phenylmethyl]carbamic acid (PubChem CID 89406680) has the molecular formula C30H40N2O4 and a molecular weight of 492.66 g/mol. Its IUPAC name is [[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[3-(9-oxononoxy)phenyl]-phenylmethyl]carbamic acid.
| Compound Name | [[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[3-(9-oxononoxy)phenyl]-phenylmethyl]carbamic acid |
|---|---|
| PubChem CID | 89406680 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | [[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[3-(9-oxononoxy)phenyl]-phenylmethyl]carbamic acid |
| SMILES | O=CCCCCCCCCOc1cccc(C(NC(=O)O)(c2ccccc2)[C@H]2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C30H40N2O4/c33-20-9-4-2-1-3-5-10-21-36-27-15-11-14-26(22-27)30(31-29(34)35,25-12-7-6-8-13-25)28-23-32-18-16-24(28)17-19-32/h6-8,11-15,20,22,24,28,31H,1-5,9-10,16-19,21,23H2,(H,34,35)/t28-,30?/m0/s1 |
| InChIKey | OPEYHUFZUBYTKP-MBCWZBCWSA-N |
| XLogP | 5.85 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|