C29H58O5Si2 — CID 91139778
methyl 7-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(3-oxopropyl)cyclopentyl]octanoate (PubChem CID 91139778) has the molecular formula C29H58O5Si2 and a molecular weight of 542.95 g/mol. Its IUPAC name is methyl 7-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(3-oxopropyl)cyclopentyl]octanoate.
| Compound Name | methyl 7-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(3-oxopropyl)cyclopentyl]octanoate |
|---|---|
| PubChem CID | 91139778 |
| Molecular Formula | C29H58O5Si2 |
| Molecular Weight | 542.95 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | methyl 7-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(3-oxopropyl)cyclopentyl]octanoate |
| SMILES | COC(=O)CCCCCC(C)C1C(O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)C1CCC=O |
| InChI | InChI=1S/C29H58O5Si2/c1-22(17-14-13-15-19-26(31)32-8)27-23(18-16-20-30)24(33-35(9,10)28(2,3)4)21-25(27)34-36(11,12)29(5,6)7/h20,22-25,27H,13-19,21H2,1-12H3 |
| InChIKey | NMPLXLDEAXXNOA-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.95 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|