C11H15N3O5 — CID 91139985
(2,5-dihydroxypyrrol-1-yl) N-[(4R)-7-oxoazepan-4-yl]carbamate (PubChem CID 91139985) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) N-[(4R)-7-oxoazepan-4-yl]carbamate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) N-[(4R)-7-oxoazepan-4-yl]carbamate |
|---|---|
| PubChem CID | 91139985 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) N-[(4R)-7-oxoazepan-4-yl]carbamate |
| SMILES | O=C1CC[C@@H](NC(=O)On2c(O)ccc2O)CCN1 |
| InChI | InChI=1S/C11H15N3O5/c15-8-2-1-7(5-6-12-8)13-11(18)19-14-9(16)3-4-10(14)17/h3-4,7,16-17H,1-2,5-6H2,(H,12,15)(H,13,18)/t7-/m1/s1 |
| InChIKey | ZMRZECGEYUKOMS-SSDOTTSWSA-N |
| XLogP | -0.29 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |