C27H31F4N7O — CID 91142392
N'-ethyl-N-[[2-fluoro-5-[[11-[4-(trifluoromethoxy)phenyl]-6,7,8,9,10,11-hexahydro-5H-[1,2,4]triazolo[1,5-a]azonin-2-yl]imino]cyclohepta-1,3,6-trien-1-yl]amino]ethanimidamide (PubChem CID 91142392) has the molecular formula C27H31F4N7O and a molecular weight of 545.59 g/mol. Its IUPAC name is N'-ethyl-N-[[2-fluoro-5-[[11-[4-(trifluoromethoxy)phenyl]-6,7,8,9,10,11-hexahydro-5H-[1,2,4]triazolo[1,5-a]azonin-2-yl]imino]cyclohepta-1,3,6-trien-1-yl]amino]ethanimidamide.
| Compound Name | N'-ethyl-N-[[2-fluoro-5-[[11-[4-(trifluoromethoxy)phenyl]-6,7,8,9,10,11-hexahydro-5H-[1,2,4]triazolo[1,5-a]azonin-2-yl]imino]cyclohepta-1,3,6-trien-1-yl]amino]ethanimidamide |
|---|---|
| PubChem CID | 91142392 |
| Molecular Formula | C27H31F4N7O |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | N'-ethyl-N-[[2-fluoro-5-[[11-[4-(trifluoromethoxy)phenyl]-6,7,8,9,10,11-hexahydro-5H-[1,2,4]triazolo[1,5-a]azonin-2-yl]imino]cyclohepta-1,3,6-trien-1-yl]amino]ethanimidamide |
| SMILES | CC/N=C(\C)NNc1ccc(=Nc2nc3n(n2)CCCCCCC3c2ccc(OC(F)(F)F)cc2)ccc1F |
| InChI | InChI=1S/C27H31F4N7O/c1-3-32-18(2)35-36-24-16-12-20(11-15-23(24)28)33-26-34-25-22(8-6-4-5-7-17-38(25)37-26)19-9-13-21(14-10-19)39-27(29,30)31/h9-16,22,36H,3-8,17H2,1-2H3,(H,32,35) |
| InChIKey | NVSLLELXPLEQLO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|