C26H32FN7O — CID 90936679
10-(4-ethoxyphenyl)-N-[6-fluoro-5-(3-methyl-1,2,4-triazol-1-yl)hepta-2,4,6-trien-2-yl]-4,6,7,8,9,10-hexahydro-[1,3,5]triazino[1,2-a]azepin-2-amine (PubChem CID 90936679) has the molecular formula C26H32FN7O and a molecular weight of 477.59 g/mol. Its IUPAC name is 10-(4-ethoxyphenyl)-N-[6-fluoro-5-(3-methyl-1,2,4-triazol-1-yl)hepta-2,4,6-trien-2-yl]-4,6,7,8,9,10-hexahydro-[1,3,5]triazino[1,2-a]azepin-2-amine.
| Compound Name | 10-(4-ethoxyphenyl)-N-[6-fluoro-5-(3-methyl-1,2,4-triazol-1-yl)hepta-2,4,6-trien-2-yl]-4,6,7,8,9,10-hexahydro-[1,3,5]triazino[1,2-a]azepin-2-amine |
|---|---|
| PubChem CID | 90936679 |
| Molecular Formula | C26H32FN7O |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 10-(4-ethoxyphenyl)-N-[6-fluoro-5-(3-methyl-1,2,4-triazol-1-yl)hepta-2,4,6-trien-2-yl]-4,6,7,8,9,10-hexahydro-[1,3,5]triazino[1,2-a]azepin-2-amine |
| SMILES | C=C(F)C(=CC=C(C)NC1=NCN2CCCCC(c3ccc(OCC)cc3)C2=N1)n1cnc(C)n1 |
| InChI | InChI=1S/C26H32FN7O/c1-5-35-22-12-10-21(11-13-22)23-8-6-7-15-33-16-29-26(31-25(23)33)30-18(2)9-14-24(19(3)27)34-17-28-20(4)32-34/h9-14,17,23H,3,5-8,15-16H2,1-2,4H3,(H,29,30) |
| InChIKey | JMLRXQUKHDQOIF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 79.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|