C17H16N2O2S — CID 91145565
4-(4-methoxyanilino)-2-methyl-5-phenyl-1,2-thiazol-3-one (PubChem CID 91145565) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-(4-methoxyanilino)-2-methyl-5-phenyl-1,2-thiazol-3-one.
| Compound Name | 4-(4-methoxyanilino)-2-methyl-5-phenyl-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 91145565 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4-(4-methoxyanilino)-2-methyl-5-phenyl-1,2-thiazol-3-one |
| SMILES | COc1ccc(Nc2c(-c3ccccc3)sn(C)c2=O)cc1 |
| InChI | InChI=1S/C17H16N2O2S/c1-19-17(20)15(16(22-19)12-6-4-3-5-7-12)18-13-8-10-14(21-2)11-9-13/h3-11,18H,1-2H3 |
| InChIKey | GAFBIMGVIIRAJL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |