C10H12FN5O7P+ — CID 91146638
[(2S,3R,4R)-3-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]-trihydroxyphosphanium (PubChem CID 91146638) has the molecular formula C10H12FN5O7P+ and a molecular weight of 364.21 g/mol. Its IUPAC name is [(2S,3R,4R)-3-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]-trihydroxyphosphanium.
| Compound Name | [(2S,3R,4R)-3-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 91146638 |
| Molecular Formula | C10H12FN5O7P+ |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [(2S,3R,4R)-3-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]-trihydroxyphosphanium |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@]1(O)[C@H](O)CO[C@@H]1C(=O)[P+](O)(O)O |
| InChI | InChI=1S/C10H12FN5O7P/c11-9-14-6(12)4-7(15-9)16(2-13-4)10(19)3(17)1-23-5(10)8(18)24(20,21)22/h2-3,5,17,19-22H,1H2,(H2,12,14,15)/q+1/t3-,5-,10-/m1/s1 |
| InChIKey | GZJPILGZRBRXMC-AHHSDZFFSA-N |
| XLogP | -2.78 |
| TPSA | 197.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|