C21H23FN4O3 — CID 91150039
6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-N-propyl-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-11-carboxamide (PubChem CID 91150039) has the molecular formula C21H23FN4O3 and a molecular weight of 398.44 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-N-propyl-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-11-carboxamide.
| Compound Name | 6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-N-propyl-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-11-carboxamide |
|---|---|
| PubChem CID | 91150039 |
| Molecular Formula | C21H23FN4O3 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-N-propyl-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-11-carboxamide |
| SMILES | CCCNC(=O)C1C(=O)N2CCNc3c(Cc4ccc(F)cc4)cnc(c32)C1O |
| InChI | InChI=1S/C21H23FN4O3/c1-2-7-24-20(28)15-19(27)17-18-16(23-8-9-26(18)21(15)29)13(11-25-17)10-12-3-5-14(22)6-4-12/h3-6,11,15,19,23,27H,2,7-10H2,1H3,(H,24,28) |
| InChIKey | UFEZZOPCFPAZHI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|