C30H43O5P — CID 91152753
(1R,7R,15S,17R)-15-methyl-7-[3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13-methylidene-11-phosphanyloxy-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 91152753) has the molecular formula C30H43O5P and a molecular weight of 514.64 g/mol. Its IUPAC name is (1R,7R,15S,17R)-15-methyl-7-[3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13-methylidene-11-phosphanyloxy-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | (1R,7R,15S,17R)-15-methyl-7-[3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13-methylidene-11-phosphanyloxy-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 91152753 |
| Molecular Formula | C30H43O5P |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (1R,7R,15S,17R)-15-methyl-7-[3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13-methylidene-11-phosphanyloxy-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=C1CC(OP)C=CC[C@@H](CC=C[C@@H]2CC(C)=CCO2)OC(=O)C=CC[C@@H]2C=CC[C@@H](C[C@@H](C)C1)O2 |
| InChI | InChI=1S/C30H43O5P/c1-22-16-17-32-27(19-22)12-4-9-26-10-6-14-29(35-36)21-24(3)18-23(2)20-28-13-5-8-25(33-28)11-7-15-30(31)34-26/h4-8,12,14-16,23,25-29H,3,9-11,13,17-21,36H2,1-2H3/t23-,25-,26+,27+,28-,29?/m0/s1 |
| InChIKey | FPUCXYAUQVKFJD-SXBJYHEISA-N |
| XLogP | 6.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|