C28H20F6N2O4 — CID 91154316
5-hydroxy-2,6-bis[2-[4-(trifluoromethyl)phenyl]ethyl]-5H-pyrrolo[3,4-f]isoindole-1,3,7-trione (PubChem CID 91154316) has the molecular formula C28H20F6N2O4 and a molecular weight of 562.47 g/mol. Its IUPAC name is 5-hydroxy-2,6-bis[2-[4-(trifluoromethyl)phenyl]ethyl]-5H-pyrrolo[3,4-f]isoindole-1,3,7-trione.
| Compound Name | 5-hydroxy-2,6-bis[2-[4-(trifluoromethyl)phenyl]ethyl]-5H-pyrrolo[3,4-f]isoindole-1,3,7-trione |
|---|---|
| PubChem CID | 91154316 |
| Molecular Formula | C28H20F6N2O4 |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 5-hydroxy-2,6-bis[2-[4-(trifluoromethyl)phenyl]ethyl]-5H-pyrrolo[3,4-f]isoindole-1,3,7-trione |
| SMILES | O=C1c2cc3c(cc2C(=O)N1CCc1ccc(C(F)(F)F)cc1)C(O)N(CCc1ccc(C(F)(F)F)cc1)C3=O |
| InChI | InChI=1S/C28H20F6N2O4/c29-27(30,31)17-5-1-15(2-6-17)9-11-35-23(37)19-13-21-22(14-20(19)24(35)38)26(40)36(25(21)39)12-10-16-3-7-18(8-4-16)28(32,33)34/h1-8,13-14,23,37H,9-12H2 |
| InChIKey | XDMNPTDRXYGDCW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|