C26H36F6O6 — CID 91154448
1,2-dimethoxyethane;1,2-dimethoxypropane;1-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]-4-methoxybenzene (PubChem CID 91154448) has the molecular formula C26H36F6O6 and a molecular weight of 558.56 g/mol. Its IUPAC name is 1,2-dimethoxyethane;1,2-dimethoxypropane;1-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]-4-methoxybenzene.
| Compound Name | 1,2-dimethoxyethane;1,2-dimethoxypropane;1-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]-4-methoxybenzene |
|---|---|
| PubChem CID | 91154448 |
| Molecular Formula | C26H36F6O6 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 1,2-dimethoxyethane;1,2-dimethoxypropane;1-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]-4-methoxybenzene |
| SMILES | COCC(C)OC.COCCOC.COc1ccc(C(c2ccc(OC)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F6O2.C5H12O2.C4H10O2/c1-24-13-7-3-11(4-8-13)15(16(18,19)20,17(21,22)23)12-5-9-14(25-2)10-6-12;1-5(7-3)4-6-2;1-5-3-4-6-2/h3-10H,1-2H3;5H,4H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | BKTULHSQFZUGDJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|